CAS 1823184-47-9 is the registry number for 6-(Trifluoromethoxy)spiro[benzo[e][1,3]oxazine-2,4'-piperidin]-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethoxy)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one (CAS 1823184-47-9) is a chemical compound with the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. IUPAC name: 6-(trifluoromethoxy)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one. InChIKey: HELXYVBWNMUKQF-UHFFFAOYSA-N.
| Molecular formula | C13H13F3N2O3 |
|---|---|
| Molecular weight | 302.25 g/mol |
| IUPAC name | 6-(trifluoromethoxy)spiro[3H-1,3-benzoxazine-2,4'-piperidine]-4-one |
| InChIKey | HELXYVBWNMUKQF-UHFFFAOYSA-N |
| SMILES | C1CNCCC12NC(=O)C3=C(O2)C=CC(=C3)OC(F)(F)F |
Computed by PubChem (NCBI)