CAS 1461708-08-6 is the registry number for 4H-1,2,4-Triazol-3-yl(3-(trifluoromethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 1461708-08-6) is a chemical compound with the molecular formula C10H10ClF3N4 and a molecular weight of 278.66 g/mol. IUPAC name: 1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: HZULNPZUCDSHBD-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N4 |
|---|---|
| Molecular weight | 278.66 g/mol |
| IUPAC name | 1H-1,2,4-triazol-5-yl-[3-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | HZULNPZUCDSHBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C2=NC=NN2)N.Cl |
Computed by PubChem (NCBI)