CAS 871338-43-1 is the registry number for 1-(tert-Butyl)-4-chloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-tert-butyl-4-chloro-3-(trifluoromethyl)pyrazolo[5,4-d]pyrimidine (CAS 871338-43-1) is a chemical compound with the molecular formula C10H10ClF3N4 and a molecular weight of 278.66 g/mol. IUPAC name: 1-tert-butyl-4-chloro-3-(trifluoromethyl)pyrazolo[5,4-d]pyrimidine. InChIKey: LRRBSBYKUDBUCC-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF3N4 |
|---|---|
| Molecular weight | 278.66 g/mol |
| IUPAC name | 1-tert-butyl-4-chloro-3-(trifluoromethyl)pyrazolo[5,4-d]pyrimidine |
| InChIKey | LRRBSBYKUDBUCC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C(=N1)C(F)(F)F)C(=NC=N2)Cl |
Computed by PubChem (NCBI)