CAS 1461709-10-3 is the registry number for 1-(2-Amino-1,3-thiazol-4-yl)-2-chloroethan-1-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2-amino-1,3-thiazol-4-yl)-2-chloroethanone;hydrochloride (CAS 1461709-10-3) is a chemical compound with the molecular formula C5H6Cl2N2OS and a molecular weight of 213.08 g/mol. IUPAC name: 1-(2-amino-1,3-thiazol-4-yl)-2-chloroethanone;hydrochloride. InChIKey: DCALHAPSZHYYIR-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl2N2OS |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | 1-(2-amino-1,3-thiazol-4-yl)-2-chloroethanone;hydrochloride |
| InChIKey | DCALHAPSZHYYIR-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)C(=O)CCl.Cl |
Computed by PubChem (NCBI)