CAS 66313-72-2 appears in our catalog under these names: 2-(2-Amino-4-thiazolyl)acetyl Chloride Hydrochloride, ≥95%, ≥95%, Cefotiam Impurity 18. Offered by: Chemat, Chemat Brand. Available pack sizes: 100mg, 250mg, 1g, 5g, on request.
2-(2-amino-1,3-thiazol-4-yl)acetyl chloride;hydrochloride (CAS 66313-72-2) is a chemical compound with the molecular formula C5H6Cl2N2OS and a molecular weight of 213.08 g/mol. IUPAC name: 2-(2-amino-1,3-thiazol-4-yl)acetyl chloride;hydrochloride. InChIKey: QOYSDZKXYFHSEJ-UHFFFAOYSA-N.
| Molecular formula | C5H6Cl2N2OS |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | 2-(2-amino-1,3-thiazol-4-yl)acetyl chloride;hydrochloride |
| InChIKey | QOYSDZKXYFHSEJ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)N)CC(=O)Cl.Cl |
Computed by PubChem (NCBI)