CAS 1461713-69-8 appears in our catalog under these names: 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%, 1-(2,3-Difluorophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,3-difluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1461713-69-8) is a chemical compound with the molecular formula C8H7ClF5N and a molecular weight of 247.59 g/mol. IUPAC name: 1-(2,3-difluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: GQQSNPDNZZHMJH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF5N |
|---|---|
| Molecular weight | 247.59 g/mol |
| IUPAC name | 1-(2,3-difluorophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | GQQSNPDNZZHMJH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)