Products 1803595-05-2
CAS 1803595-05-2 is the registry number for (2,5-Difluoro-4-(trifluoromethyl)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2,5-difluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 1803595-05-2) is a chemical compound with the molecular formula C8H7ClF5N and a molecular weight of 247.59 g/mol. IUPAC name: [2,5-difluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: UJMOOMXYZUGQEH-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF5N |
|---|---|
| Molecular weight | 247.59 g/mol |
| IUPAC name | [2,5-difluoro-4-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | UJMOOMXYZUGQEH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(F)(F)F)F)CN.Cl |
Computed by PubChem (NCBI)