CAS 1461713-86-9 is the registry number for 1-(Piperidine-3-sulfonyl)-2,3-dihydro-1H-indole hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-piperidin-3-ylsulfonyl-2,3-dihydroindole;hydrochloride (CAS 1461713-86-9) is a chemical compound with the molecular formula C13H19ClN2O2S and a molecular weight of 302.82 g/mol. IUPAC name: 1-piperidin-3-ylsulfonyl-2,3-dihydroindole;hydrochloride. InChIKey: SIYLOVWFHOPFGL-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O2S |
|---|---|
| Molecular weight | 302.82 g/mol |
| IUPAC name | 1-piperidin-3-ylsulfonyl-2,3-dihydroindole;hydrochloride |
| InChIKey | SIYLOVWFHOPFGL-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)S(=O)(=O)N2CCC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)