CAS 1580413-73-5 is the registry number for 1-(2,3-Dihydro-1H-indene-5-sulfonyl)piperazine hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine;hydrochloride (CAS 1580413-73-5) is a chemical compound with the molecular formula C13H19ClN2O2S and a molecular weight of 302.82 g/mol. IUPAC name: 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine;hydrochloride. InChIKey: RMFRWRFDMZJAHC-UHFFFAOYSA-N.
| Molecular formula | C13H19ClN2O2S |
|---|---|
| Molecular weight | 302.82 g/mol |
| IUPAC name | 1-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine;hydrochloride |
| InChIKey | RMFRWRFDMZJAHC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)S(=O)(=O)N3CCNCC3.Cl |
Computed by PubChem (NCBI)