Products 1461715-56-9
CAS 1461715-56-9 appears in our catalog under these names: tert-Butyl N-(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamate, tert-Butyl (4-methyl-2-phenylthiazol-5-yl)carbamate, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
Tert-butyl N-(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamate (CAS 1461715-56-9) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: tert-butyl N-(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamate. InChIKey: AISOBSGFPJMBSH-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | tert-butyl N-(4-methyl-2-phenyl-1,3-thiazol-5-yl)carbamate |
| InChIKey | AISOBSGFPJMBSH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=CC=C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)