CAS 14618-48-5 appears in our catalog under these names: N-(2,5-Dimethylphenyl)-2,2,2-trifluoroacetamide, 98%, Acetamide, N-(2,5-dimethylphenyl)-2,2,2-trifluoro-, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 25g, 1g, 5g, 10g.
N-(2,5-dimethylphenyl)-2,2,2-trifluoroacetamide (CAS 14618-48-5) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: N-(2,5-dimethylphenyl)-2,2,2-trifluoroacetamide. InChIKey: KFUHMDMHSVWBTG-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | N-(2,5-dimethylphenyl)-2,2,2-trifluoroacetamide |
| InChIKey | KFUHMDMHSVWBTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)