CAS 146204-01-5 appears in our catalog under these names: 1-(Benzyloxy)-2,3-difluoro-4-iodobenzene, 95%, 1-(Benzyloxy)-2,3-difluoro-4-iodobenzene, 98%, 1-(Benzyloxy)-2,3-difluoro-4-iodobenzene, ≥95%, ≥95%, 1-(Benzyloxy)-2,3-difluoro-4-iodobenzene. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,3-difluoro-1-iodo-4-phenylmethoxybenzene (CAS 146204-01-5) is a chemical compound with the molecular formula C13H9F2IO and a molecular weight of 346.11 g/mol. IUPAC name: 2,3-difluoro-1-iodo-4-phenylmethoxybenzene. InChIKey: NLXPYNYXSXAWIA-UHFFFAOYSA-N.
| Molecular formula | C13H9F2IO |
|---|---|
| Molecular weight | 346.11 g/mol |
| IUPAC name | 2,3-difluoro-1-iodo-4-phenylmethoxybenzene |
| InChIKey | NLXPYNYXSXAWIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)I)F)F |
Computed by PubChem (NCBI)