CAS 2764728-16-5 is the registry number for 2-(Benzyloxy)-1,3-difluoro-5-iodobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,3-difluoro-5-iodo-2-phenylmethoxybenzene (CAS 2764728-16-5) is a chemical compound with the molecular formula C13H9F2IO and a molecular weight of 346.11 g/mol. IUPAC name: 1,3-difluoro-5-iodo-2-phenylmethoxybenzene. InChIKey: JFQAYLRRQOTYDF-UHFFFAOYSA-N.
| Molecular formula | C13H9F2IO |
|---|---|
| Molecular weight | 346.11 g/mol |
| IUPAC name | 1,3-difluoro-5-iodo-2-phenylmethoxybenzene |
| InChIKey | JFQAYLRRQOTYDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)I)F |
Computed by PubChem (NCBI)