Products 14625-40-2
CAS 14625-40-2 appears in our catalog under these names: 2-(Chloromethyl)-6-methoxy-1H-1,3-benzodiazole, 2-(Chloromethyl)-6-methoxy-1H-benzo(d)imidazole, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(chloromethyl)-6-methoxy-1H-benzimidazole (CAS 14625-40-2) is a chemical compound with the molecular formula C9H9ClN2O and a molecular weight of 196.63 g/mol. IUPAC name: 2-(chloromethyl)-6-methoxy-1H-benzimidazole. InChIKey: WZEWEZMUYDNMCZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 2-(chloromethyl)-6-methoxy-1H-benzimidazole |
| InChIKey | WZEWEZMUYDNMCZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(N2)CCl |
Computed by PubChem (NCBI)