CAS 14625-58-2 is the registry number for 2-(3-Methylphenyl)benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-(3-methylphenyl)-1,3-benzoxazole (CAS 14625-58-2) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 209.24 g/mol. IUPAC name: 2-(3-methylphenyl)-1,3-benzoxazole. InChIKey: PNVRWCOOQDYUJY-UHFFFAOYSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2-(3-methylphenyl)-1,3-benzoxazole |
| InChIKey | PNVRWCOOQDYUJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)