Products 1463056-47-4
CAS 1463056-47-4 is the registry number for 1-Ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d]imidazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole (CAS 1463056-47-4) is a chemical compound with the molecular formula C15H21BN2O2 and a molecular weight of 272.15 g/mol. IUPAC name: 1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole. InChIKey: GFPHFPQMLSZKFE-UHFFFAOYSA-N.
| Molecular formula | C15H21BN2O2 |
|---|---|
| Molecular weight | 272.15 g/mol |
| IUPAC name | 1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzimidazole |
| InChIKey | GFPHFPQMLSZKFE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N=CN3CC |
Computed by PubChem (NCBI)