Products 1463522-61-3

CAS 1463522-61-3 is the registry number for rac-tert-Butyl N-((1S,3S)-3-(hydrazinecarbonyl)cyclobutyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[3-(hydrazinecarbonyl)cyclobutyl]carbamate (CAS 1463522-61-3) is a chemical compound with the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. IUPAC name: tert-butyl N-[3-(hydrazinecarbonyl)cyclobutyl]carbamate. InChIKey: PWPORVNQJHDZBS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H19N3O3
Molecular weight229.28 g/mol
IUPAC nametert-butyl N-[3-(hydrazinecarbonyl)cyclobutyl]carbamate
InChIKeyPWPORVNQJHDZBS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC(C1)C(=O)NN

Computed by PubChem (NCBI)