Products 146388-56-9
CAS 146388-56-9 is the registry number for CGP 43487. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(E,4R)-4-amino-5-ethoxy-2-methyl-5-oxopent-2-enyl]phosphonic acid (CAS 146388-56-9) is a chemical compound with the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. IUPAC name: [(E,4R)-4-amino-5-ethoxy-2-methyl-5-oxopent-2-enyl]phosphonic acid. InChIKey: OKDOWCKDTWNRCB-PTYLAXBQSA-N.
| Molecular formula | C8H16NO5P |
|---|---|
| Molecular weight | 237.19 g/mol |
| IUPAC name | [(E,4R)-4-amino-5-ethoxy-2-methyl-5-oxopent-2-enyl]phosphonic acid |
| InChIKey | OKDOWCKDTWNRCB-PTYLAXBQSA-N |
| SMILES | CCOC(=O)[C@@H](/C=C(\C)/CP(=O)(O)O)N |
Computed by PubChem (NCBI)