CAS 146404-58-2 appears in our catalog under these names: Cinnamylphosphonic acid, 95%, Phosphonic acid, P-(3-phenyl-2-propen-1-yl)-, 98%, Cinnamylphosphonic acid, Cinnamylphosphonic Acid, >98.0%(HPLC), Cinnamylphosphonic acid (E), ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg.
[(E)-3-phenylprop-2-enyl]phosphonic acid (CAS 146404-58-2) is a chemical compound with the molecular formula C9H11O3P and a molecular weight of 198.16 g/mol. IUPAC name: [(E)-3-phenylprop-2-enyl]phosphonic acid. InChIKey: AIWAKBITCLOITM-QPJJXVBHSA-N.
| Molecular formula | C9H11O3P |
|---|---|
| Molecular weight | 198.16 g/mol |
| IUPAC name | [(E)-3-phenylprop-2-enyl]phosphonic acid |
| InChIKey | AIWAKBITCLOITM-QPJJXVBHSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/CP(=O)(O)O |
Computed by PubChem (NCBI)