Products 75777-31-0

CAS 75777-31-0 is the registry number for 1-Ethoxy-1,3-dihydro-2,1-benzoxaphosphole 1-oxide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-ethoxy-3H-2,1lambda5-benzoxaphosphole 1-oxide (CAS 75777-31-0) is a chemical compound with the molecular formula C9H11O3P and a molecular weight of 198.16 g/mol. IUPAC name: 1-ethoxy-3H-2,1lambda5-benzoxaphosphole 1-oxide. InChIKey: BSKCRPRZPDCVKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11O3P
Molecular weight198.16 g/mol
IUPAC name1-ethoxy-3H-2,1lambda5-benzoxaphosphole 1-oxide
InChIKeyBSKCRPRZPDCVKZ-UHFFFAOYSA-N
SMILESCCOP1(=O)C2=CC=CC=C2CO1

Computed by PubChem (NCBI)