CAS 1464177-15-8 is the registry number for Methyl 2-hydroxy-3-mesitylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoate (CAS 1464177-15-8) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: methyl 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoate. InChIKey: ORKGVIKRJRZMSR-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | methyl 2-hydroxy-3-(2,4,6-trimethylphenyl)propanoate |
| InChIKey | ORKGVIKRJRZMSR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(C(=O)OC)O)C |
Computed by PubChem (NCBI)