CAS 146464-93-9 appears in our catalog under these names: 4-(1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid, 95%, Pralatrexate Impurity 2, 4-(1-(2,4-Diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid, 97%, 10-Propargyl-4-deoxy-4-amino-10-deazapteroic Acid, 4-(1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl)benzoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, AmBeed, TRC, Biosynth. Available pack sizes: 250mg, 1g, on request, 100mg, 50mg, 10mg, 25mg, 25 mg.
4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoic acid (CAS 146464-93-9) is a chemical compound with the molecular formula C18H16N6O2 and a molecular weight of 348.4 g/mol. IUPAC name: 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoic acid. InChIKey: YDEZNQPWTMVPCH-UHFFFAOYSA-N.
| Molecular formula | C18H16N6O2 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoic acid |
| InChIKey | YDEZNQPWTMVPCH-UHFFFAOYSA-N |
| SMILES | C#CCC(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)