CAS 16889-10-4 is the registry number for Disperse Red 73. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
2-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile (CAS 16889-10-4) is a chemical compound with the molecular formula C18H16N6O2 and a molecular weight of 348.4 g/mol. IUPAC name: 2-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile. InChIKey: QEORVDCGZONWCJ-UHFFFAOYSA-N.
| Molecular formula | C18H16N6O2 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[[4-[2-cyanoethyl(ethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile |
| InChIKey | QEORVDCGZONWCJ-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)