CAS 1464922-83-5 is the registry number for N-(5-bromo-2-fluorophenyl)pivalamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(5-bromo-2-fluorophenyl)-2,2-dimethylpropanamide (CAS 1464922-83-5) is a chemical compound with the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. IUPAC name: N-(5-bromo-2-fluorophenyl)-2,2-dimethylpropanamide. InChIKey: AISFHLLXNHSMRK-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFNO |
|---|---|
| Molecular weight | 274.13 g/mol |
| IUPAC name | N-(5-bromo-2-fluorophenyl)-2,2-dimethylpropanamide |
| InChIKey | AISFHLLXNHSMRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)