CAS 146499-42-5 is the registry number for (S)-tert-Butyl 2-((tert-butyldimethylsilyl)oxy)-4-oxobutanoate. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxobutanoate (CAS 146499-42-5) is a chemical compound with the molecular formula C14H28O4Si and a molecular weight of 288.45 g/mol. IUPAC name: tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxobutanoate. InChIKey: ONPPDNOABQXUDF-NSHDSACASA-N.
| Molecular formula | C14H28O4Si |
|---|---|
| Molecular weight | 288.45 g/mol |
| IUPAC name | tert-butyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-oxobutanoate |
| InChIKey | ONPPDNOABQXUDF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)