CAS 1909318-75-7 appears in our catalog under these names: tert-Butyl 2-{(2-(tert-butoxy)-2-oxoethyl)dimethylsilyl}acetate, 95%, tert-Butyl 2-{(2-(tert-butoxy)-2-oxoethyl)dimethylsilyl}acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 2-[dimethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]silyl]acetate (CAS 1909318-75-7) is a chemical compound with the molecular formula C14H28O4Si and a molecular weight of 288.45 g/mol. IUPAC name: tert-butyl 2-[dimethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]silyl]acetate. InChIKey: HVXYIHDUONYAGZ-UHFFFAOYSA-N.
| Molecular formula | C14H28O4Si |
|---|---|
| Molecular weight | 288.45 g/mol |
| IUPAC name | tert-butyl 2-[dimethyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]silyl]acetate |
| InChIKey | HVXYIHDUONYAGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C[Si](C)(C)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)