CAS 1465247-69-1 appears in our catalog under these names: 1-(1-Methoxypropan-2-yl)-2-(trifluoromethyl)-1H-1,3-benzodiazol-5-amine, 1-(1-Methoxypropan-2-yl)-2-(trifluoromethyl)-1H-1,3-benzodiazol-5-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(1-methoxypropan-2-yl)-2-(trifluoromethyl)benzimidazol-5-amine (CAS 1465247-69-1) is a chemical compound with the molecular formula C12H14F3N3O and a molecular weight of 273.25 g/mol. IUPAC name: 1-(1-methoxypropan-2-yl)-2-(trifluoromethyl)benzimidazol-5-amine. InChIKey: FBNUXQYPAQIIGR-UHFFFAOYSA-N.
| Molecular formula | C12H14F3N3O |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | 1-(1-methoxypropan-2-yl)-2-(trifluoromethyl)benzimidazol-5-amine |
| InChIKey | FBNUXQYPAQIIGR-UHFFFAOYSA-N |
| SMILES | CC(COC)N1C2=C(C=C(C=C2)N)N=C1C(F)(F)F |
Computed by PubChem (NCBI)