CAS 792940-04-6 appears in our catalog under these names: 1-[5-(Trifluoromethyl)pyridin-2-yl]piperidine-4-carboxamide, 95%, 1-(5-Trifluoromethylpyridin-2-yl)-4-piperidinecarboxamide, 95.0%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide (CAS 792940-04-6) is a chemical compound with the molecular formula C12H14F3N3O and a molecular weight of 273.25 g/mol. IUPAC name: 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide. InChIKey: KYNFSNWMELNTIW-UHFFFAOYSA-N.
| Molecular formula | C12H14F3N3O |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | 1-[5-(trifluoromethyl)-2-pyridinyl]piperidine-4-carboxamide |
| InChIKey | KYNFSNWMELNTIW-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)N)C2=NC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)