CAS 146535-00-4 appears in our catalog under these names: 2-(3,5-Difluorophenyl)-2-oxoacetaldehyde, 95%, 2-(3,5-Difluorophenyl)-2-oxoacetaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(3,5-difluorophenyl)-2-oxoacetaldehyde (CAS 146535-00-4) is a chemical compound with the molecular formula C8H4F2O2 and a molecular weight of 170.11 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-2-oxoacetaldehyde. InChIKey: HSUIFIUPBOLDGF-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O2 |
|---|---|
| Molecular weight | 170.11 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-2-oxoacetaldehyde |
| InChIKey | HSUIFIUPBOLDGF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)C=O |
Computed by PubChem (NCBI)