CAS 857062-57-8 appears in our catalog under these names: 4,6-Difluoro-2,3-dihydro-1-benzofuran-3-one, 95%, 4,6-Difluoro-2,3-dihydro-1-benzofuran-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4,6-difluoro-1-benzofuran-3-one (CAS 857062-57-8) is a chemical compound with the molecular formula C8H4F2O2 and a molecular weight of 170.11 g/mol. IUPAC name: 4,6-difluoro-1-benzofuran-3-one. InChIKey: WFXCNBKZBYQYLP-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O2 |
|---|---|
| Molecular weight | 170.11 g/mol |
| IUPAC name | 4,6-difluoro-1-benzofuran-3-one |
| InChIKey | WFXCNBKZBYQYLP-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C=C(C=C2F)F |
Computed by PubChem (NCBI)