CAS 146552-71-8 appears in our catalog under these names: (S),-tert-Butyl (1-aminopropan-2-yl),carbamate, 95%, 95%, (S)-TERT-BUTYL 1-AMINOPROPAN-2-YLCARBAMATE, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Tert-butyl N-[(2S)-1-aminopropan-2-yl]carbamate (CAS 146552-71-8) is a chemical compound with the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. IUPAC name: tert-butyl N-[(2S)-1-aminopropan-2-yl]carbamate. InChIKey: JQXZBJAAOLPTKP-LURJTMIESA-N.
| Molecular formula | C8H18N2O2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-aminopropan-2-yl]carbamate |
| InChIKey | JQXZBJAAOLPTKP-LURJTMIESA-N |
| SMILES | C[C@@H](CN)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)