Products 146552-73-0
CAS 146552-73-0 is the registry number for (S)-Benzyl (1-amino-3-phenylpropan-2-yl)carbamate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;hydrochloride (CAS 146552-73-0) is a chemical compound with the molecular formula C17H21ClN2O2 and a molecular weight of 320.8 g/mol. IUPAC name: benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;hydrochloride. InChIKey: LUDUDVBVCIPEJP-NTISSMGPSA-N.
| Molecular formula | C17H21ClN2O2 |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | benzyl N-[(2S)-1-amino-3-phenylpropan-2-yl]carbamate;hydrochloride |
| InChIKey | LUDUDVBVCIPEJP-NTISSMGPSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CN)NC(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)