CAS 553631-33-7 appears in our catalog under these names: 1-N-Boc-4-(3-chlorophenyl)-4-cyanopiperidine, 95%, tert–Butyl 4–(3–chlorophenyl)–4–cyanopiperidine–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 5g, 1g.
Tert-butyl 4-(3-chlorophenyl)-4-cyanopiperidine-1-carboxylate (CAS 553631-33-7) is a chemical compound with the molecular formula C17H21ClN2O2 and a molecular weight of 320.8 g/mol. IUPAC name: tert-butyl 4-(3-chlorophenyl)-4-cyanopiperidine-1-carboxylate. InChIKey: ZQSUUNQAAQFFOC-UHFFFAOYSA-N.
| Molecular formula | C17H21ClN2O2 |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | tert-butyl 4-(3-chlorophenyl)-4-cyanopiperidine-1-carboxylate |
| InChIKey | ZQSUUNQAAQFFOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C#N)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)