CAS 1465907-72-5 is the registry number for DXR-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(3,4-dichlorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfanylmethyl]phosphonic acid (CAS 1465907-72-5) is a chemical compound with the molecular formula C10H12Cl2NO5PS and a molecular weight of 360.15 g/mol. IUPAC name: [(3,4-dichlorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfanylmethyl]phosphonic acid. InChIKey: FCHGYCPRLYDAIK-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2NO5PS |
|---|---|
| Molecular weight | 360.15 g/mol |
| IUPAC name | [(3,4-dichlorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethyl]sulfanylmethyl]phosphonic acid |
| InChIKey | FCHGYCPRLYDAIK-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CSC(C1=CC(=C(C=C1)Cl)Cl)P(=O)(O)O)O |
Computed by PubChem (NCBI)