CAS 171605-91-7 appears in our catalog under these names: Xiaochongliulin, Xiaochongliulin, >95% (HPLC). Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 250mg, 500mg, 50mg, 1x10mg.
(2,4-dichloro-6-nitrophenoxy)-diethoxy-sulfanylidene-lambda5-phosphane (CAS 171605-91-7) is a chemical compound with the molecular formula C10H12Cl2NO5PS and a molecular weight of 360.15 g/mol. IUPAC name: (2,4-dichloro-6-nitrophenoxy)-diethoxy-sulfanylidene-lambda5-phosphane. InChIKey: LVHRDEVAWFGKBI-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2NO5PS |
|---|---|
| Molecular weight | 360.15 g/mol |
| IUPAC name | (2,4-dichloro-6-nitrophenoxy)-diethoxy-sulfanylidene-lambda5-phosphane |
| InChIKey | LVHRDEVAWFGKBI-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)OC1=C(C=C(C=C1Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)