Products 1466227-72-4
CAS 1466227-72-4 is the registry number for (5-(3-Fluoropyridin-4-yl)-1,3,4-thiadiazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-(3-fluoro-4-pyridinyl)-1,3,4-thiadiazol-2-yl]methanamine (CAS 1466227-72-4) is a chemical compound with the molecular formula C8H7FN4S and a molecular weight of 210.23 g/mol. IUPAC name: [5-(3-fluoro-4-pyridinyl)-1,3,4-thiadiazol-2-yl]methanamine. InChIKey: AWLJLTIPZFCKDN-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | [5-(3-fluoro-4-pyridinyl)-1,3,4-thiadiazol-2-yl]methanamine |
| InChIKey | AWLJLTIPZFCKDN-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C2=NN=C(S2)CN)F |
Computed by PubChem (NCBI)