CAS 565174-22-3 appears in our catalog under these names: 4-Amino-5-(2-fluorophenyl)-4h-1,2,4-triazole-3-thiol, 95%, 4-Amino-5-(2-fluorophenyl)-4H-1,2,4-triazole-3-thiol, 95+%, 4-amino-3-(2-fluorophenyl)-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95+%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 50mg, 500mg, 2.5g.
4-amino-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione (CAS 565174-22-3) is a chemical compound with the molecular formula C8H7FN4S and a molecular weight of 210.23 g/mol. IUPAC name: 4-amino-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: FVYAMLSLCJJJHJ-UHFFFAOYSA-N.
| Molecular formula | C8H7FN4S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-amino-3-(2-fluorophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | FVYAMLSLCJJJHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=S)N2N)F |
Computed by PubChem (NCBI)