CAS 1466427-02-0 appears in our catalog under these names: Endothelial lipase inhibitor-1/ 97.38% (existing batch purity), Endothelial lipase inhibitor–1, Endothelial lipase inhibitor-1, Endothelial lipase inhibitor-1, 98.02%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
5-amino-2,4-dioxo-N-[(1R)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1H-pyrimidine-6-carboxamide (CAS 1466427-02-0) is a chemical compound with the molecular formula C22H22N4O4 and a molecular weight of 406.4 g/mol. IUPAC name: 5-amino-2,4-dioxo-N-[(1R)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1H-pyrimidine-6-carboxamide. InChIKey: DZBXQBHHXZDUJS-MRXNPFEDSA-N.
| Molecular formula | C22H22N4O4 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 5-amino-2,4-dioxo-N-[(1R)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-yl]-1H-pyrimidine-6-carboxamide |
| InChIKey | DZBXQBHHXZDUJS-MRXNPFEDSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=CC=C2)OCC3=CC=CC=C3)NC(=O)C4=C(C(=O)NC(=O)N4)N |
Computed by PubChem (NCBI)