Products 2470063-59-1
CAS 2470063-59-1 is the registry number for Tubulin polymerization-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]aniline (CAS 2470063-59-1) is a chemical compound with the molecular formula C22H22N4O4 and a molecular weight of 406.4 g/mol. IUPAC name: 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]aniline. InChIKey: UHDXUJRRMFTWMJ-UHFFFAOYSA-N.
| Molecular formula | C22H22N4O4 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]aniline |
| InChIKey | UHDXUJRRMFTWMJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C(=NN=C3C4=CC(=C(C(=C4)OC)OC)OC)C=C2)N |
Computed by PubChem (NCBI)
Synonyms:
Tubulin polymerization-IN-11