CAS 146645-63-8 appears in our catalog under these names: H–Trp(Boc)–OH, H-Trp(Boc)-OH, H-Trp(Boc)-OH 97%, 1-Boc-D-tryptophan, 97%, 97%, H-Trp(Boc)-OH, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 0,1kg, 0,25kg, 1g, 5g, 250mg, 10g.
(2S)-2-amino-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid (CAS 146645-63-8) is a chemical compound with the molecular formula C16H20N2O4 and a molecular weight of 304.34 g/mol. IUPAC name: (2S)-2-amino-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid. InChIKey: DYWUPCCKOVTCFZ-LBPRGKRZSA-N.
| Molecular formula | C16H20N2O4 |
|---|---|
| Molecular weight | 304.34 g/mol |
| IUPAC name | (2S)-2-amino-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]propanoic acid |
| InChIKey | DYWUPCCKOVTCFZ-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)