CAS 14665-75-9 appears in our catalog under these names: Phenylephrine Impurity 10, 2-Amino-3’-hydroxy-acetophenone Hydrochloride, >95% (HPLC), 2-Amino-3â„¢-hydroxy-acetophenone Hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 25mg.
2-amino-1-(3-hydroxyphenyl)ethanone;hydrochloride (CAS 14665-75-9) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 2-amino-1-(3-hydroxyphenyl)ethanone;hydrochloride. InChIKey: KNXFQMJCHAKLKF-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 2-amino-1-(3-hydroxyphenyl)ethanone;hydrochloride |
| InChIKey | KNXFQMJCHAKLKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)CN.Cl |
Computed by PubChem (NCBI)