Products 1467658-45-2

CAS 1467658-45-2 is the registry number for 5-(Thiophen-2-yl)thiomorpholine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

5-thiophen-2-ylthiomorpholine-3-carboxylic acid (CAS 1467658-45-2) is a chemical compound with the molecular formula C9H11NO2S2 and a molecular weight of 229.3 g/mol. IUPAC name: 5-thiophen-2-ylthiomorpholine-3-carboxylic acid. InChIKey: BPXMMQROYXXOJT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO2S2
Molecular weight229.3 g/mol
IUPAC name5-thiophen-2-ylthiomorpholine-3-carboxylic acid
InChIKeyBPXMMQROYXXOJT-UHFFFAOYSA-N
SMILESC1C(NC(CS1)C(=O)O)C2=CC=CS2

Computed by PubChem (NCBI)