CAS 1574078-69-5 is the registry number for N-Methoxy-N-methyl-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methoxy-N-methyl-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide (CAS 1574078-69-5) is a chemical compound with the molecular formula C9H11NO2S2 and a molecular weight of 229.3 g/mol. IUPAC name: N-methoxy-N-methyl-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide. InChIKey: CPAZTQZMKOLVKL-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S2 |
|---|---|
| Molecular weight | 229.3 g/mol |
| IUPAC name | N-methoxy-N-methyl-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide |
| InChIKey | CPAZTQZMKOLVKL-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=CC2=C(S1)CSC2)OC |
Computed by PubChem (NCBI)