CAS 1468718-86-6 is the registry number for 1-{2-Amino-6-methyl-4H,5H,6H,7H-thieno(2,3-c)pyridin-3-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)ethanone (CAS 1468718-86-6) is a chemical compound with the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. IUPAC name: 1-(2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)ethanone. InChIKey: FAUHWXMLCUNGNK-UHFFFAOYSA-N.
| Molecular formula | C10H14N2OS |
|---|---|
| Molecular weight | 210.30 g/mol |
| IUPAC name | 1-(2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-3-yl)ethanone |
| InChIKey | FAUHWXMLCUNGNK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(SC2=C1CCN(C2)C)N |
Computed by PubChem (NCBI)