CAS 1468756-11-7 appears in our catalog under these names: tert-Butyl N-(1-methanesulfonylpropan-2-yl)carbamate, 95%, tert-Butyl N-(1-methanesulfonylpropan-2-yl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-(1-methylsulfonylpropan-2-yl)carbamate (CAS 1468756-11-7) is a chemical compound with the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. IUPAC name: tert-butyl N-(1-methylsulfonylpropan-2-yl)carbamate. InChIKey: ZQSMVAHUIPRGBQ-UHFFFAOYSA-N.
| Molecular formula | C9H19NO4S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | tert-butyl N-(1-methylsulfonylpropan-2-yl)carbamate |
| InChIKey | ZQSMVAHUIPRGBQ-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)