Products 1469306-93-1
CAS 1469306-93-1 is the registry number for 3-(3-Fluoro-4-methoxyphenyl)-2,2-dimethylpyrrolidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-fluoro-4-methoxyphenyl)-2,2-dimethylpyrrolidine (CAS 1469306-93-1) is a chemical compound with the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)-2,2-dimethylpyrrolidine. InChIKey: ADFBBMMNMXHTGG-UHFFFAOYSA-N.
| Molecular formula | C13H18FNO |
|---|---|
| Molecular weight | 223.29 g/mol |
| IUPAC name | 3-(3-fluoro-4-methoxyphenyl)-2,2-dimethylpyrrolidine |
| InChIKey | ADFBBMMNMXHTGG-UHFFFAOYSA-N |
| SMILES | CC1(C(CCN1)C2=CC(=C(C=C2)OC)F)C |
Computed by PubChem (NCBI)