CAS 147027-05-2 is the registry number for Trans-5-acetoxy-1,3-oxathiolane-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid (CAS 147027-05-2) is a chemical compound with the molecular formula C6H8O5S and a molecular weight of 192.19 g/mol. IUPAC name: (2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid. InChIKey: WRUGSNIJLUOGQF-INEUFUBQSA-N.
| Molecular formula | C6H8O5S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | (2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid |
| InChIKey | WRUGSNIJLUOGQF-INEUFUBQSA-N |
| SMILES | CC(=O)O[C@H]1CS[C@@H](O1)C(=O)O |
Computed by PubChem (NCBI)