Products 147027-05-2

CAS 147027-05-2 is the registry number for Trans-5-acetoxy-1,3-oxathiolane-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid (CAS 147027-05-2) is a chemical compound with the molecular formula C6H8O5S and a molecular weight of 192.19 g/mol. IUPAC name: (2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid. InChIKey: WRUGSNIJLUOGQF-INEUFUBQSA-N.

Identity
Molecular formulaC6H8O5S
Molecular weight192.19 g/mol
IUPAC name(2R,5R)-5-acetyloxy-1,3-oxathiolane-2-carboxylic acid
InChIKeyWRUGSNIJLUOGQF-INEUFUBQSA-N
SMILESCC(=O)O[C@H]1CS[C@@H](O1)C(=O)O

Computed by PubChem (NCBI)