CAS 58941-08-5 appears in our catalog under these names: 2-Methyl-5,6-dihydro-1,4-oxathiine-3-carboxylic acid 4,4-dioxide, 95%, 2-Methyl-5,6-dihydro-1,4-oxathiine-3-carboxylic acid 4,4-dioxide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
6-methyl-4,4-dioxo-2,3-dihydro-1,4-oxathiine-5-carboxylic acid (CAS 58941-08-5) is a chemical compound with the molecular formula C6H8O5S and a molecular weight of 192.19 g/mol. IUPAC name: 6-methyl-4,4-dioxo-2,3-dihydro-1,4-oxathiine-5-carboxylic acid. InChIKey: CADWMFXAOSMONN-UHFFFAOYSA-N.
| Molecular formula | C6H8O5S |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 6-methyl-4,4-dioxo-2,3-dihydro-1,4-oxathiine-5-carboxylic acid |
| InChIKey | CADWMFXAOSMONN-UHFFFAOYSA-N |
| SMILES | CC1=C(S(=O)(=O)CCO1)C(=O)O |
Computed by PubChem (NCBI)