Products 1470362-85-6
CAS 1470362-85-6 appears in our catalog under these names: Citalopram Impurity 14, Escitalopram Amide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxamide (CAS 1470362-85-6) is a chemical compound with the molecular formula C20H23FN2O2 and a molecular weight of 342.4 g/mol. IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxamide. InChIKey: LYYWQJNKWCANAC-FQEVSTJZSA-N.
| Molecular formula | C20H23FN2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carboxamide |
| InChIKey | LYYWQJNKWCANAC-FQEVSTJZSA-N |
| SMILES | CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C(=O)N)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)