Products 481047-48-7
CAS 481047-48-7 appears in our catalog under these names: Citalopram Impurity 26((R)-Citadiol), (R)-Citadiol. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 50mg, 100mg.
4-[(1R)-4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile (CAS 481047-48-7) is a chemical compound with the molecular formula C20H23FN2O2 and a molecular weight of 342.4 g/mol. IUPAC name: 4-[(1R)-4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile. InChIKey: GNULRNVWXYXBQY-HXUWFJFHSA-N.
| Molecular formula | C20H23FN2O2 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 4-[(1R)-4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)benzonitrile |
| InChIKey | GNULRNVWXYXBQY-HXUWFJFHSA-N |
| SMILES | CN(C)CCC[C@@](C1=CC=C(C=C1)F)(C2=C(C=C(C=C2)C#N)CO)O |
Computed by PubChem (NCBI)